| CAS No.: | 122008-85-9 |
|---|---|
| Formula: | C16h12fno4 |
| Appearance: | Liquid |
| Method of Application: | Cauline Leaf, Soil Treatment Agent |
| Usage: | Selective |
| Composition: | Organic |
| Customization: |
|---|
Suppliers with verified business licenses
Audited Supplier Cyhalofop-Butyl of Herbicide Pesticide (100g/l EC, 180g/l EC, 200g/l EC)
Description: A selective herbicide used for post-emergence control of grass weeds usually in rice crops
Example pests controlled: Barnyardgrass; Silver top; Rice flatsedge; Arrowhead; Junglerice; Pigweed; Cocklebur
Example applications: Rice
Chemical structure:
| Isomerism | A chiral molecule in which the R-isomer is by far the most dominant and often accounts for over 95% of cyhalofop-butyl |
| Chemical formula | C16H12FNO4 |
| Canonical SMILES | CCCCOC(=O)C(C)OC1=CC=C(C=C1)OC2=C(C=C(C=C2)C#N)F |
| Isomeric SMILES | CCCCOC(=O)[C@@H](C)OC1=CC=C(C=C1)OC2=C(C=C(C=C2)C#N)F |
| International Chemical Identifier key (InChIKey) | TYIYMOAHACZAMQ-CQSZACIVSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C20H20FNO4/c1-3-4-11-24-20(23)14(2)25-16-6-8-17(9-7-16)26-19-10-5-15(13-22)12-18(19)21/h5-10,12,14H,3-4,11H2,1-2H3/t14-/m1/s1 |
| Pesticide type | Herbicide |
| Substance group | Aryloxyphenoxypropionate |
| Minimum active substance purity | 950 g/kg |
| Known relevant impurities | EU dossier - None declared |
| Substance origin | Synthetic |
| Mode of action | Systemic, foliar untake with no soil activity. ACCase inhibitor. |
| CAS RN | 122008-85-9 |
| EC number | - |
| CIPAC number | 596 |
| US EPA chemical code | 082583 |
| PubChem CID | 180089 |
| Molecular mass (g mol-1) | 357.38 |
| PIN (Preferred Identification Name) | butyl (2R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoate |
| IUPAC name | butyl (R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propionate |
| CAS name | butyl (2R)-2-(4-(4-cyano-2-fluorophenoxy)phenoxy)propanoate |
Suppliers with verified business licenses
Audited Supplier 
){kind=link}
){kind=link}