| Customization: | Available |
|---|---|
| CAS No.: | 173584-44-6 |
| Formula: | C22h17clf3n3o7 |
Suppliers with verified business licenses
Audited by an independent third-party inspection agency
| Isomerism | A chiral molecule, existing in the R- and S-forms but normally used as the S-stereosomer |
| Chemical formula | C22H17ClF3N3O7 |
| Canonical SMILES | COC(=O)C12CC3=C(C1=NN(CO2)C(=O)N(C4=CC=C(C=C4)OC(F)(F)F)C(=O)OC)C=CC(=C3)Cl |
| Isomeric SMILES | COC(=O)[C@]12CC3=C(C1=NN(CO2)C(=O)N(C4=CC=C(C=C4)OC(F)(F)F)C(=O)OC)C=CC(=C3)Cl |
| International Chemical Identifier key (InChIKey) | VBCVPMMZEGZULK-NRFANRHFSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C22H17ClF3N3O7/c1-33-18(30)21-10-12-9-13(23)3-8-16(12)17(21)27-28(11-35-21)19(31)29(20(32)34-2)14-4-6-15(7-5-14)36-22(24,25)26/h3-9H,10-11H2,1-2H3/t21-/m0/s1 |
| Pesticide type | Insecticide |
| Substance group | Oxadiazine |
| Minimum active substance purity | 930 g/kg |
| Known relevant impurities | EU 2017 dossier - 4,4'-methylenebis(N,N-diethylaniline < 0.0025 g/kg |
| Substance origin | Synthetic |
| Mode of action | Contact and stomach action. Voltage-dependent sodium channel blocker. |
| CAS RN | 173584-44-6 |
| EC number | - |
| CIPAC number | 612 |
| US EPA chemical code | 118200 |
| PubChem CID | 107720 |
| Molecular mass (g mol-1) | 527.83 |
| PIN (Preferred Identification Name) | methyl (S)-N-[7-chloro-2,3,4a,5-tetrahydro-4a-(methoxycarbonyl)indeno[1,2-e][1,3,4]oxadiazin-2-ylcarbonyl]-4'-(trifluoromethoxy)carbanilate |
| IUPAC name | methyl (S)-N-[7-chloro-2,3,4a,5-tetrahydro-4a-(methoxycarbonyl)indeno[1,2-e][1,3,4]oxadiazin-2-ylcarbonyl]-4'-(trifluoromethoxy)carbanilate |
| CAS name | methyl (4aS)-7-chloro-2,5-dihydro-2-(((methoxycarbonyl)(4-(trifluoromethoxy)phenyl)amino])carbonyl)indeno(1,2-e)(1,3,4)oxadiazine-4a(3H)-carboxylate |


