| Customization: | Available |
|---|---|
| CAS No.: | 19666-30-9 |
| Formula: | C15h18cl2n2o3 |
Suppliers with verified business licenses
Audited Supplier Audited by an independent third-party inspection agency
Herbicide Pesticide Oxadiazon 250g/L EC
Description: A pre-emergent or early post-emergent herbicide used to control bindweed and some annual broad-leaved weeds in food and non-food situations
Example pests controlled: Crabgrass; Annual bluegrass; Goosegrass; Buttonweed; Annual sedge
Example applications: Turf, sports greens & ornamental grass; Non-cropped areas including playgrounds, roadsides; cemeteries; Ornamental shrubs, Vines; Trees
Chemical structure:
| Isomerism | - |
| Chemical formula | C15H18Cl2N2O3 |
| Canonical SMILES | CC(C)OC1=C(C=C(C(=C1)N2C(=O)OC(=N2)C(C)(C)C)Cl)Cl |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | CHNUNORXWHYHNE-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C15H18Cl2N2O3/c1-8(2)21-12-7-11(9(16)6-10(12)17)19-14(20)22-13(18-19)15(3,4)5/h6-8H,1-5H3 |
| Pesticide type | Herbicide |
| Substance group | Oxidiazole |
| Minimum active substance purity | - |
| Known relevant impurities | EU dossier - None declared |
| Substance origin | Synthetic |
| Mode of action | Selective with contact action. Inhibits protoporphyrinogen oxidase, leading to irreversible cell membrane damage. |
| CAS RN | 19666-30-9 |
| EC number | 243-215-7 |
| CIPAC number | 213 |
| US EPA chemical code | 109001 |
| PubChem CID | 29732 |
| Molecular mass (g mol-1) | 345.2 |
| PIN (Preferred Identification Name) | - |
| IUPAC name | 5-tert-butyl-3-(2,4-dichloro-5-isopropoxyphenyl)-1,3,4-oxadiazol-2(3H)-one |
| CAS name | 3-(2,4-dichloro-5-(1-methylethoxy)phenyl)-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one |
){kind=link}