Herbicide Pesticide 2, 4-D Dimethylamine (720g/l SL, 480g/l SL)
IUPAC name dimethylammonium (2,4-dichlorophenoxy)acetate
CAS RN [2008-39-1] EC no. 217-915-8
Description: A translocated phenoxy herbicide for use in cereals, grass and amenity use.
Example pests controlled: Broad-leaved weeds, Evasive weeds in aquatic situations
Example applications: Turf grass & pastures; Non-cropping situations; Amenity sites; Almonds; Orchards; Cereals including barley, wheat and oats; Lucerne
Chemical structure:
| Isomerism |
- |
| Chemical formula |
C10H13Cl2NO3 |
| Canonical SMILES |
CNC.C1=CC(=C(C=C1Cl)Cl)OCC(=O)O |
| Isomeric SMILES |
No data |
| International Chemical Identifier key (InChIKey) |
IUQJDHJVPLLKFL-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) |
InChI=1S/C8H6Cl2O3.C2H7N/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;1-3-2/h1-3H,4H2,(H,11,12);3H,1-2H3 |
General status:
| Pesticide type |
Herbicide, Plant growth regulator |
| Substance group |
Alkylchlorophenoxy |
| Minimum active substance purity |
- |
| Known relevant impurities |
- |
| Substance origin |
Synthetic |
| Mode of action |
Selective, systemic, absorbed through roots and increases biosynthesis and production of ethylene causing uncontrolled cell division and so damages vascular tissue. Synthetic auxin. |
| CAS RN |
2008-39-1 |
| EC number |
217-915-8 |
| CIPAC number |
1 |
| US EPA chemical code |
030019 |
| PubChem CID |
16180 |
| Molecular mass (g mol-1) |
266.12 |
| PIN (Preferred Identification Name) |
(2,4-dichlorophenoxy)acetic acid N-methylmethanamine (1/1) |
| IUPAC name |
dimethylammonium (2,4-dichlorophenoxy)acetate |
| CAS name |
2-(2,4-dichlorophenoxy)acetic acid compound with N-methylmethanamine (1:1) |
| Other status information |
- |
| Relevant Environmental Water Quality Standards |
UK statutory standard for protection of aquatic life for inland, coastal & territorial surface waters: 1.0 ug/L as annual mean conc |
Audited Supplier 
Audited Supplier 
){kind=link}
){kind=link}