Pymetrozine 30% FS Insecticide Pesticide
Description: A novel azomethine insecticide suitable for use in integrated crop management to control aphids and other plant sucking pests
Example pests controlled: Pollen beetles; Aphids; Whiteflies
Example applications: OSR; Potatoes; Brassicas; Spinach; Cucumbers; Ornamentals
Chemical structure:
Isomerism |
Isomeric |
Chemical formula |
C10H11N5O |
Canonical SMILES |
CC1=NNC(=O)N(C1)N=CC2=CN=CC=C2 |
Isomeric SMILES |
CC1=NNC(=O)N(C1)/N=C/C2=CN=CC=C2 |
International Chemical Identifier key (InChIKey) |
QHMTXANCGGJZRX-WUXMJOGZSA-N |
International Chemical Identifier (InChI) |
InChI=1S/C10H11N5O/c1-8-7-15(10(16)14-13-8)12-6-9-3-2-4-11-5-9/h2-6H,7H2,1H3,(H,14,16)/b12-6+ |
General status:
Pesticide type |
Insecticide |
Substance group |
Pyridine |
Minimum active substance purity |
970 g/kg |
Known relevant impurities |
EU dossier - None declared |
Substance origin |
Synthetic |
Mode of action |
Selective, neural inhibition of feeding behavior that eventually starves insect. |
CAS RN |
123312-89-0 |
EC number |
- |
CIPAC number |
593 |
US EPA chemical code |
101103 |
PubChem CID |
9576037 |
Molecular mass (g mol-1) |
217.23 |
PIN (Preferred Identification Name) |
- |
IUPAC name |
(E)-4,5-dihydro-6-methyl-4-(3-pyridylmethyleneamino)-1,2,4-triazin-3(2H)-one |
CAS name |
4,5-dihydro-6-methyl-4-((E)-(3-pyridinylmethylene)amino)-1,2,4-triazin-3(2H)-one |